About N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide
N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide (PubChem CID 164642741) has the molecular formula C10H15F2NO
and a molecular weight of 203.23 g/mol. Its IUPAC name is N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide.
Molecular Properties
| Compound Name | N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide |
| PubChem CID | 164642741 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1CC=CC1)C(C)(F)F |
| InChI | InChI=1S/C10H15F2NO/c1-7(10(2,11)12)13-9(14)8-5-3-4-6-8/h3-4,7-8H,5-6H2,1-2H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | XIFSQCMHANZZTK-ZETCQYMHSA-N |
| XLogP | 2.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide?
The IUPAC name of N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide (CID 164642741) is N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide.
What is the SMILES notation for N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide?
The canonical SMILES for N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide is C[C@H](NC(=O)C1CC=CC1)C(C)(F)F.
What is the InChIKey of N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide?
The InChIKey is XIFSQCMHANZZTK-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H15F2NO/c1-7(10(2,11)12)13-9(14)8-5-3-4-6-8/h3-4,7-8H,5-6H2,1-2H3,(H,13,14)/t7-/m0/s1.
What are the key properties of N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide?
N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide has a molecular weight of 203.23 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-3,3-difluorobutan-2-yl]cyclopent-3-ene-1-carboxamide is sourced from PubChem (CID 164642741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).