About (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide
(1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide (PubChem CID 164642746) has the molecular formula C10H13F2N3O
and a molecular weight of 229.23 g/mol. Its IUPAC name is (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide |
| PubChem CID | 164642746 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide |
| SMILES | CC(C)c1cn[nH]c1NC(=O)[C@H]1CC1(F)F |
| InChI | InChI=1S/C10H13F2N3O/c1-5(2)6-4-13-15-8(6)14-9(16)7-3-10(7,11)12/h4-5,7H,3H2,1-2H3,(H2,13,14,15,16)/t7-/m1/s1 |
| InChIKey | RHVPOODCBZGVKX-SSDOTTSWSA-N |
| XLogP | 2.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide?
The IUPAC name of (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide (CID 164642746) is (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide.
What is the SMILES notation for (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide?
The canonical SMILES for (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide is CC(C)c1cn[nH]c1NC(=O)[C@H]1CC1(F)F.
What is the InChIKey of (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide?
The InChIKey is RHVPOODCBZGVKX-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H13F2N3O/c1-5(2)6-4-13-15-8(6)14-9(16)7-3-10(7,11)12/h4-5,7H,3H2,1-2H3,(H2,13,14,15,16)/t7-/m1/s1.
What are the key properties of (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide?
(1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide has a molecular weight of 229.23 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-difluoro-N-(4-propan-2-yl-1H-pyrazol-5-yl)cyclopropane-1-carboxamide is sourced from PubChem (CID 164642746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).