About N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide
N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide (PubChem CID 164642819) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 164642819 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide |
| SMILES | CO[C@@H](CNC(=O)c1ccon1)C(C)(C)C |
| InChI | InChI=1S/C11H18N2O3/c1-11(2,3)9(15-4)7-12-10(14)8-5-6-16-13-8/h5-6,9H,7H2,1-4H3,(H,12,14)/t9-/m0/s1 |
| InChIKey | LMWCFUSBNUIMFZ-VIFPVBQESA-N |
| XLogP | 1.47 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide (CID 164642819) is N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide is CO[C@@H](CNC(=O)c1ccon1)C(C)(C)C.
What is the InChIKey of N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide?
The InChIKey is LMWCFUSBNUIMFZ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H18N2O3/c1-11(2,3)9(15-4)7-12-10(14)8-5-6-16-13-8/h5-6,9H,7H2,1-4H3,(H,12,14)/t9-/m0/s1.
What are the key properties of N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide?
N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide has a molecular weight of 226.28 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-methoxy-3,3-dimethylbutyl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 164642819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).