C12H19N5O — CID 164643058
(1S,6S)-6-[(2-ethyl-1,2,4-triazol-3-yl)methylamino]cyclohex-3-ene-1-carboxamide (PubChem CID 164643058) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is (1S,6S)-6-[(2-ethyl-1,2,4-triazol-3-yl)methylamino]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S,6S)-6-[(2-ethyl-1,2,4-triazol-3-yl)methylamino]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 164643058 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (1S,6S)-6-[(2-ethyl-1,2,4-triazol-3-yl)methylamino]cyclohex-3-ene-1-carboxamide |
| SMILES | CCn1ncnc1CN[C@H]1CC=CC[C@@H]1C(N)=O |
| InChI | InChI=1S/C12H19N5O/c1-2-17-11(15-8-16-17)7-14-10-6-4-3-5-9(10)12(13)18/h3-4,8-10,14H,2,5-7H2,1H3,(H2,13,18)/t9-,10-/m0/s1 |
| InChIKey | RAOJJNZDGITJHB-UWVGGRQHSA-N |
| XLogP | 0.21 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|