C17H23N5O — CID 164643219
N-(3-ethylphenyl)-2-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]acetamide (PubChem CID 164643219) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is N-(3-ethylphenyl)-2-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(3-ethylphenyl)-2-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 164643219 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-(3-ethylphenyl)-2-[(3S)-3-(1,2,4-triazol-1-yl)piperidin-1-yl]acetamide |
| SMILES | CCc1cccc(NC(=O)CN2CCC[C@H](n3cncn3)C2)c1 |
| InChI | InChI=1S/C17H23N5O/c1-2-14-5-3-6-15(9-14)20-17(23)11-21-8-4-7-16(10-21)22-13-18-12-19-22/h3,5-6,9,12-13,16H,2,4,7-8,10-11H2,1H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | YAHWQXRDYKHWGH-INIZCTEOSA-N |
| XLogP | 2.12 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |