About N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide
N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide (PubChem CID 164643271) has the molecular formula C14H23N3O2
and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide |
| PubChem CID | 164643271 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide |
| SMILES | CC(C)N(C(=O)c1ccnn1C(C)C)[C@H]1CCOC1 |
| InChI | InChI=1S/C14H23N3O2/c1-10(2)16(12-6-8-19-9-12)14(18)13-5-7-15-17(13)11(3)4/h5,7,10-12H,6,8-9H2,1-4H3/t12-/m0/s1 |
| InChIKey | MRHIOLVOUBGWGB-LBPRGKRZSA-N |
| XLogP | 2.10 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide?
The IUPAC name of N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide (CID 164643271) is N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide.
What is the SMILES notation for N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide?
The canonical SMILES for N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide is CC(C)N(C(=O)c1ccnn1C(C)C)[C@H]1CCOC1.
What is the InChIKey of N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide?
The InChIKey is MRHIOLVOUBGWGB-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H23N3O2/c1-10(2)16(12-6-8-19-9-12)14(18)13-5-7-15-17(13)11(3)4/h5,7,10-12H,6,8-9H2,1-4H3/t12-/m0/s1.
What are the key properties of N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide?
N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide has a molecular weight of 265.36 g/mol, XLogP of 2.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-oxolan-3-yl]-N,2-di(propan-2-yl)pyrazole-3-carboxamide is sourced from PubChem (CID 164643271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).