About 3-isocyanato-N,N-dimethylpyridin-2-amine
3-isocyanato-N,N-dimethylpyridin-2-amine (PubChem CID 164643508) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-isocyanato-N,N-dimethylpyridin-2-amine.
Molecular Properties
| Compound Name | 3-isocyanato-N,N-dimethylpyridin-2-amine |
| PubChem CID | 164643508 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 3-isocyanato-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1ncccc1N=C=O |
| InChI | InChI=1S/C8H9N3O/c1-11(2)8-7(10-6-12)4-3-5-9-8/h3-5H,1-2H3 |
| InChIKey | RINSENIJBPRELI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanato-N,N-dimethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanato-N,N-dimethylpyridin-2-amine?
The IUPAC name of 3-isocyanato-N,N-dimethylpyridin-2-amine (CID 164643508) is 3-isocyanato-N,N-dimethylpyridin-2-amine.
What is the SMILES notation for 3-isocyanato-N,N-dimethylpyridin-2-amine?
The canonical SMILES for 3-isocyanato-N,N-dimethylpyridin-2-amine is CN(C)c1ncccc1N=C=O.
What is the InChIKey of 3-isocyanato-N,N-dimethylpyridin-2-amine?
The InChIKey is RINSENIJBPRELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-11(2)8-7(10-6-12)4-3-5-9-8/h3-5H,1-2H3.
What are the key properties of 3-isocyanato-N,N-dimethylpyridin-2-amine?
3-isocyanato-N,N-dimethylpyridin-2-amine has a molecular weight of 163.18 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanato-N,N-dimethylpyridin-2-amine is sourced from PubChem (CID 164643508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).