C18H29BO2 — CID 164643972
2-[(E)-2-(2-adamantyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 164643972) has the molecular formula C18H29BO2 and a molecular weight of 288.24 g/mol. Its IUPAC name is 2-[(E)-2-(2-adamantyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-2-(2-adamantyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 164643972 |
| Molecular Formula | C18H29BO2 |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-[(E)-2-(2-adamantyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(/C=C/C2C3CC4CC(C3)CC2C4)OC1(C)C |
| InChI | InChI=1S/C18H29BO2/c1-17(2)18(3,4)21-19(20-17)6-5-16-14-8-12-7-13(10-14)11-15(16)9-12/h5-6,12-16H,7-11H2,1-4H3/b6-5+ |
| InChIKey | GOGSOEHEOKVOEB-AATRIKPKSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|