About 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one
2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one (PubChem CID 164644134) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one.
Molecular Properties
| Compound Name | 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one |
| PubChem CID | 164644134 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one |
| SMILES | CC1=C(C)N2CC(=O)N=C2S1 |
| InChI | InChI=1S/C7H8N2OS/c1-4-5(2)11-7-8-6(10)3-9(4)7/h3H2,1-2H3 |
| InChIKey | ZZFRUUQOHHOVFO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one?
The IUPAC name of 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one (CID 164644134) is 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one.
What is the SMILES notation for 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one?
The canonical SMILES for 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one is CC1=C(C)N2CC(=O)N=C2S1.
What is the InChIKey of 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one?
The InChIKey is ZZFRUUQOHHOVFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c1-4-5(2)11-7-8-6(10)3-9(4)7/h3H2,1-2H3.
What are the key properties of 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one?
2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one has a molecular weight of 168.22 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5H-imidazo[2,1-b][1,3]thiazol-6-one is sourced from PubChem (CID 164644134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).