C13H22ClN — CID 164644249
(2S)-1-(2-bicyclo[2.2.1]heptanylmethyl)-2-(chloromethyl)pyrrolidine (PubChem CID 164644249) has the molecular formula C13H22ClN and a molecular weight of 227.78 g/mol. Its IUPAC name is (2S)-1-(2-bicyclo[2.2.1]heptanylmethyl)-2-(chloromethyl)pyrrolidine.
| Compound Name | (2S)-1-(2-bicyclo[2.2.1]heptanylmethyl)-2-(chloromethyl)pyrrolidine |
|---|---|
| PubChem CID | 164644249 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.78 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (2S)-1-(2-bicyclo[2.2.1]heptanylmethyl)-2-(chloromethyl)pyrrolidine |
| SMILES | ClC[C@@H]1CCCN1CC1CC2CCC1C2 |
| InChI | InChI=1S/C13H22ClN/c14-8-13-2-1-5-15(13)9-12-7-10-3-4-11(12)6-10/h10-13H,1-9H2/t10?,11?,12?,13-/m0/s1 |
| InChIKey | PQYNLAZYCPIUPV-SKQCGHHBSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.78 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|