C9H12FN3O2 — CID 164645316
N-(1,4-dioxepan-6-yl)-2-fluoropyrimidin-4-amine (PubChem CID 164645316) has the molecular formula C9H12FN3O2 and a molecular weight of 213.21 g/mol. Its IUPAC name is N-(1,4-dioxepan-6-yl)-2-fluoropyrimidin-4-amine.
| Compound Name | N-(1,4-dioxepan-6-yl)-2-fluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 164645316 |
| Molecular Formula | C9H12FN3O2 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(1,4-dioxepan-6-yl)-2-fluoropyrimidin-4-amine |
| SMILES | Fc1nccc(NC2COCCOC2)n1 |
| InChI | InChI=1S/C9H12FN3O2/c10-9-11-2-1-8(13-9)12-7-5-14-3-4-15-6-7/h1-2,7H,3-6H2,(H,11,12,13) |
| InChIKey | OYVXGCJXTBBERL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |