C8H11FN4O — CID 164645422
N-[2-[(2-fluoropyrimidin-4-yl)amino]ethyl]acetamide (PubChem CID 164645422) has the molecular formula C8H11FN4O and a molecular weight of 198.20 g/mol. Its IUPAC name is N-[2-[(2-fluoropyrimidin-4-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(2-fluoropyrimidin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 164645422 |
| Molecular Formula | C8H11FN4O |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-[2-[(2-fluoropyrimidin-4-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ccnc(F)n1 |
| InChI | InChI=1S/C8H11FN4O/c1-6(14)10-4-5-11-7-2-3-12-8(9)13-7/h2-3H,4-5H2,1H3,(H,10,14)(H,11,12,13) |
| InChIKey | OIMZHGIXEXOXSW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|