About (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone
(2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone (PubChem CID 164646354) has the molecular formula C9H11ClN2O2S
and a molecular weight of 246.72 g/mol. Its IUPAC name is (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone |
| PubChem CID | 164646354 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone |
| SMILES | COC1(C)CN(C(=O)c2csc(Cl)n2)C1 |
| InChI | InChI=1S/C9H11ClN2O2S/c1-9(14-2)4-12(5-9)7(13)6-3-15-8(10)11-6/h3H,4-5H2,1-2H3 |
| InChIKey | CLGHBDSBSFYWTO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone?
The IUPAC name of (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone (CID 164646354) is (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone.
What is the SMILES notation for (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone?
The canonical SMILES for (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone is COC1(C)CN(C(=O)c2csc(Cl)n2)C1.
What is the InChIKey of (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone?
The InChIKey is CLGHBDSBSFYWTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O2S/c1-9(14-2)4-12(5-9)7(13)6-3-15-8(10)11-6/h3H,4-5H2,1-2H3.
What are the key properties of (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone?
(2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone has a molecular weight of 246.72 g/mol, XLogP of 1.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-1,3-thiazol-4-yl)-(3-methoxy-3-methylazetidin-1-yl)methanone is sourced from PubChem (CID 164646354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).