About 3-chloro-N-(1,2-thiazol-4-yl)propanamide
3-chloro-N-(1,2-thiazol-4-yl)propanamide (PubChem CID 164646364) has the molecular formula C6H7ClN2OS
and a molecular weight of 190.66 g/mol. Its IUPAC name is 3-chloro-N-(1,2-thiazol-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-chloro-N-(1,2-thiazol-4-yl)propanamide |
| PubChem CID | 164646364 |
| Molecular Formula | C6H7ClN2OS |
| Molecular Weight | 190.66 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 3-chloro-N-(1,2-thiazol-4-yl)propanamide |
| SMILES | O=C(CCCl)Nc1cnsc1 |
| InChI | InChI=1S/C6H7ClN2OS/c7-2-1-6(10)9-5-3-8-11-4-5/h3-4H,1-2H2,(H,9,10) |
| InChIKey | CRPXELREGSDOQO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-N-(1,2-thiazol-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(1,2-thiazol-4-yl)propanamide?
The IUPAC name of 3-chloro-N-(1,2-thiazol-4-yl)propanamide (CID 164646364) is 3-chloro-N-(1,2-thiazol-4-yl)propanamide.
What is the SMILES notation for 3-chloro-N-(1,2-thiazol-4-yl)propanamide?
The canonical SMILES for 3-chloro-N-(1,2-thiazol-4-yl)propanamide is O=C(CCCl)Nc1cnsc1.
What is the InChIKey of 3-chloro-N-(1,2-thiazol-4-yl)propanamide?
The InChIKey is CRPXELREGSDOQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2OS/c7-2-1-6(10)9-5-3-8-11-4-5/h3-4H,1-2H2,(H,9,10).
What are the key properties of 3-chloro-N-(1,2-thiazol-4-yl)propanamide?
3-chloro-N-(1,2-thiazol-4-yl)propanamide has a molecular weight of 190.66 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(1,2-thiazol-4-yl)propanamide is sourced from PubChem (CID 164646364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).