C8H13N3OS — CID 164646619
4,5-dimethyl-2-[(E)-4-sulfanylbut-2-enyl]-1,2,4-triazol-3-one (PubChem CID 164646619) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 4,5-dimethyl-2-[(E)-4-sulfanylbut-2-enyl]-1,2,4-triazol-3-one.
| Compound Name | 4,5-dimethyl-2-[(E)-4-sulfanylbut-2-enyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 164646619 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4,5-dimethyl-2-[(E)-4-sulfanylbut-2-enyl]-1,2,4-triazol-3-one |
| SMILES | Cc1nn(C/C=C/CS)c(=O)n1C |
| InChI | InChI=1S/C8H13N3OS/c1-7-9-11(5-3-4-6-13)8(12)10(7)2/h3-4,13H,5-6H2,1-2H3/b4-3+ |
| InChIKey | LKFKSYUFKZKPLH-ONEGZZNKSA-N |
| XLogP | 0.38 |
| TPSA | 39.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|