About 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane
4-(3-fluoropiperidin-4-yl)-1,4-thiazepane (PubChem CID 164646626) has the molecular formula C10H19FN2S
and a molecular weight of 218.34 g/mol. Its IUPAC name is 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane |
| PubChem CID | 164646626 |
| Molecular Formula | C10H19FN2S |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane |
| SMILES | FC1CNCCC1N1CCCSCC1 |
| InChI | InChI=1S/C10H19FN2S/c11-9-8-12-3-2-10(9)13-4-1-6-14-7-5-13/h9-10,12H,1-8H2 |
| InChIKey | UCUSQYPLXADAGU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane?
The IUPAC name of 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane (CID 164646626) is 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane.
What is the SMILES notation for 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane?
The canonical SMILES for 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane is FC1CNCCC1N1CCCSCC1.
What is the InChIKey of 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane?
The InChIKey is UCUSQYPLXADAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19FN2S/c11-9-8-12-3-2-10(9)13-4-1-6-14-7-5-13/h9-10,12H,1-8H2.
What are the key properties of 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane?
4-(3-fluoropiperidin-4-yl)-1,4-thiazepane has a molecular weight of 218.34 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoropiperidin-4-yl)-1,4-thiazepane is sourced from PubChem (CID 164646626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).