C11H20N2O — CID 164647039
7,7,9-trimethyl-1,2-diazaspiro[4.5]decan-3-one (PubChem CID 164647039) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 7,7,9-trimethyl-1,2-diazaspiro[4.5]decan-3-one.
| Compound Name | 7,7,9-trimethyl-1,2-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 164647039 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 7,7,9-trimethyl-1,2-diazaspiro[4.5]decan-3-one |
| SMILES | CC1CC(C)(C)CC2(CC(=O)NN2)C1 |
| InChI | InChI=1S/C11H20N2O/c1-8-4-10(2,3)7-11(5-8)6-9(14)12-13-11/h8,13H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | OAIPPPVAVYXPQD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |