About 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine
1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine (PubChem CID 164647183) has the molecular formula C8H13F2N3
and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine |
| PubChem CID | 164647183 |
| Molecular Formula | C8H13F2N3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine |
| SMILES | FC1(F)CCCN(C2=NCCN2)C1 |
| InChI | InChI=1S/C8H13F2N3/c9-8(10)2-1-5-13(6-8)7-11-3-4-12-7/h1-6H2,(H,11,12) |
| InChIKey | KMCDXVNKGCBUMU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine?
The IUPAC name of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine (CID 164647183) is 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine.
What is the SMILES notation for 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine?
The canonical SMILES for 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine is FC1(F)CCCN(C2=NCCN2)C1.
What is the InChIKey of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine?
The InChIKey is KMCDXVNKGCBUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F2N3/c9-8(10)2-1-5-13(6-8)7-11-3-4-12-7/h1-6H2,(H,11,12).
What are the key properties of 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine?
1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine has a molecular weight of 189.21 g/mol, XLogP of 0.68, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dihydro-1H-imidazol-2-yl)-3,3-difluoropiperidine is sourced from PubChem (CID 164647183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).