C5H3BrN4S2 — CID 164647376
5-(4-bromo-1,2-thiazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 164647376) has the molecular formula C5H3BrN4S2 and a molecular weight of 263.15 g/mol. Its IUPAC name is 5-(4-bromo-1,2-thiazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-bromo-1,2-thiazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 164647376 |
| Molecular Formula | C5H3BrN4S2 |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 261.90 |
| IUPAC Name | 5-(4-bromo-1,2-thiazol-3-yl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | S=c1nc(-c2nscc2Br)[nH][nH]1 |
| InChI | InChI=1S/C5H3BrN4S2/c6-2-1-12-10-3(2)4-7-5(11)9-8-4/h1H,(H2,7,8,9,11) |
| InChIKey | KMROORLZJOKFNV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|