C6H5BrN4S2 — CID 164647377
5-(4-bromo-1,2-thiazol-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione (PubChem CID 164647377) has the molecular formula C6H5BrN4S2 and a molecular weight of 277.17 g/mol. Its IUPAC name is 5-(4-bromo-1,2-thiazol-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-bromo-1,2-thiazol-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 164647377 |
| Molecular Formula | C6H5BrN4S2 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 275.91 |
| IUPAC Name | 5-(4-bromo-1,2-thiazol-3-yl)-2-methyl-1H-1,2,4-triazole-3-thione |
| SMILES | Cn1[nH]c(-c2nscc2Br)nc1=S |
| InChI | InChI=1S/C6H5BrN4S2/c1-11-6(12)8-5(9-11)4-3(7)2-13-10-4/h2H,1H3,(H,8,9,12) |
| InChIKey | YDPIZOAMPBEHOA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|