C11H11Br2NO — CID 164647677
N-(3,5-dibromophenyl)-3-methylbut-2-enamide (PubChem CID 164647677) has the molecular formula C11H11Br2NO and a molecular weight of 333.02 g/mol. Its IUPAC name is N-(3,5-dibromophenyl)-3-methylbut-2-enamide.
| Compound Name | N-(3,5-dibromophenyl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 164647677 |
| Molecular Formula | C11H11Br2NO |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.92 |
| IUPAC Name | N-(3,5-dibromophenyl)-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H11Br2NO/c1-7(2)3-11(15)14-10-5-8(12)4-9(13)6-10/h3-6H,1-2H3,(H,14,15) |
| InChIKey | WCIGPRJHTGWLGM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|