About 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine
3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine (PubChem CID 164648201) has the molecular formula C8H9FN6
and a molecular weight of 208.20 g/mol. Its IUPAC name is 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine |
| PubChem CID | 164648201 |
| Molecular Formula | C8H9FN6 |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine |
| SMILES | Cn1ncnc1CNc1nccnc1F |
| InChI | InChI=1S/C8H9FN6/c1-15-6(13-5-14-15)4-12-8-7(9)10-2-3-11-8/h2-3,5H,4H2,1H3,(H,11,12) |
| InChIKey | VSHJZLZCWRORRU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine?
The IUPAC name of 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine (CID 164648201) is 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine.
What is the SMILES notation for 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine?
The canonical SMILES for 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine is Cn1ncnc1CNc1nccnc1F.
What is the InChIKey of 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine?
The InChIKey is VSHJZLZCWRORRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FN6/c1-15-6(13-5-14-15)4-12-8-7(9)10-2-3-11-8/h2-3,5H,4H2,1H3,(H,11,12).
What are the key properties of 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine?
3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine has a molecular weight of 208.20 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]pyrazin-2-amine is sourced from PubChem (CID 164648201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).