C8H16N2O2S — CID 164648404
N-(methylsulfonimidoyl)-8-oxabicyclo[3.2.1]octan-2-amine (PubChem CID 164648404) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is N-(methylsulfonimidoyl)-8-oxabicyclo[3.2.1]octan-2-amine.
| Compound Name | N-(methylsulfonimidoyl)-8-oxabicyclo[3.2.1]octan-2-amine |
|---|---|
| PubChem CID | 164648404 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | N-(methylsulfonimidoyl)-8-oxabicyclo[3.2.1]octan-2-amine |
| SMILES | [H]N=S(C)(=O)NC1CCC2CCC1O2 |
| InChI | InChI=1S/C8H16N2O2S/c1-13(9,11)10-7-4-2-6-3-5-8(7)12-6/h6-8H,2-5H2,1H3,(H2,9,10,11) |
| InChIKey | QIPKLLCNFUOYCR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |