About (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane
(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane (PubChem CID 164648425) has the molecular formula C8H15FN2OS
and a molecular weight of 206.29 g/mol. Its IUPAC name is (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane.
Molecular Properties
| Compound Name | (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane |
| PubChem CID | 164648425 |
| Molecular Formula | C8H15FN2OS |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane |
| SMILES | [H]N=S(=O)(C(C)C)N1CCC=C(F)C1 |
| InChI | InChI=1S/C8H15FN2OS/c1-7(2)13(10,12)11-5-3-4-8(9)6-11/h4,7,10H,3,5-6H2,1-2H3 |
| InChIKey | NSLJFKCDTZEDRU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane?
The IUPAC name of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane (CID 164648425) is (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane.
What is the SMILES notation for (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane?
The canonical SMILES for (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane is [H]N=S(=O)(C(C)C)N1CCC=C(F)C1.
What is the InChIKey of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane?
The InChIKey is NSLJFKCDTZEDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FN2OS/c1-7(2)13(10,12)11-5-3-4-8(9)6-11/h4,7,10H,3,5-6H2,1-2H3.
What are the key properties of (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane?
(5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane has a molecular weight of 206.29 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-3,6-dihydro-2H-pyridin-1-yl)-imino-oxo-propan-2-yl-λ6-sulfane is sourced from PubChem (CID 164648425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).