C8H13N3O — CID 164648520
2-[(1S,2R)-2-aminocyclopentyl]-N-cyanoacetamide (PubChem CID 164648520) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-[(1S,2R)-2-aminocyclopentyl]-N-cyanoacetamide.
| Compound Name | 2-[(1S,2R)-2-aminocyclopentyl]-N-cyanoacetamide |
|---|---|
| PubChem CID | 164648520 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-[(1S,2R)-2-aminocyclopentyl]-N-cyanoacetamide |
| SMILES | N#CNC(=O)C[C@@H]1CCC[C@H]1N |
| InChI | InChI=1S/C8H13N3O/c9-5-11-8(12)4-6-2-1-3-7(6)10/h6-7H,1-4,10H2,(H,11,12)/t6-,7+/m0/s1 |
| InChIKey | OKTAMZRJOJJUCV-NKWVEPMBSA-N |
| XLogP | 0.10 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|