C10H13N3S — CID 164648652
4-(3-piperazin-1-ylprop-1-ynyl)-1,2-thiazole (PubChem CID 164648652) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is 4-(3-piperazin-1-ylprop-1-ynyl)-1,2-thiazole.
| Compound Name | 4-(3-piperazin-1-ylprop-1-ynyl)-1,2-thiazole |
|---|---|
| PubChem CID | 164648652 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-(3-piperazin-1-ylprop-1-ynyl)-1,2-thiazole |
| SMILES | C(#Cc1cnsc1)CN1CCNCC1 |
| InChI | InChI=1S/C10H13N3S/c1(2-10-8-12-14-9-10)5-13-6-3-11-4-7-13/h8-9,11H,3-7H2 |
| InChIKey | UDENXTZKHHRNQN-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|