C10H10N2OS — CID 164648705
2-methoxy-5-(1,2-thiazol-4-yl)aniline (PubChem CID 164648705) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-methoxy-5-(1,2-thiazol-4-yl)aniline.
| Compound Name | 2-methoxy-5-(1,2-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 164648705 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-methoxy-5-(1,2-thiazol-4-yl)aniline |
| SMILES | COc1ccc(-c2cnsc2)cc1N |
| InChI | InChI=1S/C10H10N2OS/c1-13-10-3-2-7(4-9(10)11)8-5-12-14-6-8/h2-6H,11H2,1H3 |
| InChIKey | IJBJYLUTMMERPW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|