About (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine
(3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine (PubChem CID 164648754) has the molecular formula C11H18N2S
and a molecular weight of 210.35 g/mol. Its IUPAC name is (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine.
Molecular Properties
| Compound Name | (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine |
| PubChem CID | 164648754 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine |
| SMILES | CC1CCCC(C(N)c2cnsc2)C1 |
| InChI | InChI=1S/C11H18N2S/c1-8-3-2-4-9(5-8)11(12)10-6-13-14-7-10/h6-9,11H,2-5,12H2,1H3 |
| InChIKey | DGKPYHQJKZVFOS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine?
The IUPAC name of (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine (CID 164648754) is (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine.
What is the SMILES notation for (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine?
The canonical SMILES for (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine is CC1CCCC(C(N)c2cnsc2)C1.
What is the InChIKey of (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine?
The InChIKey is DGKPYHQJKZVFOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2S/c1-8-3-2-4-9(5-8)11(12)10-6-13-14-7-10/h6-9,11H,2-5,12H2,1H3.
What are the key properties of (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine?
(3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine has a molecular weight of 210.35 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl)-(1,2-thiazol-4-yl)methanamine is sourced from PubChem (CID 164648754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).