About 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine
2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine (PubChem CID 164649192) has the molecular formula C10H15F2N
and a molecular weight of 187.23 g/mol. Its IUPAC name is 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine.
Molecular Properties
| Compound Name | 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine |
| PubChem CID | 164649192 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine |
| SMILES | C/C(=C\C1CC1(F)F)C1CCCN1 |
| InChI | InChI=1S/C10H15F2N/c1-7(9-3-2-4-13-9)5-8-6-10(8,11)12/h5,8-9,13H,2-4,6H2,1H3/b7-5+ |
| InChIKey | GVDDCRXZZGVCPO-FNORWQNLSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine?
The IUPAC name of 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine (CID 164649192) is 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine.
What is the SMILES notation for 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine?
The canonical SMILES for 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine is C/C(=C\C1CC1(F)F)C1CCCN1.
What is the InChIKey of 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine?
The InChIKey is GVDDCRXZZGVCPO-FNORWQNLSA-N. The full InChI is InChI=1S/C10H15F2N/c1-7(9-3-2-4-13-9)5-8-6-10(8,11)12/h5,8-9,13H,2-4,6H2,1H3/b7-5+.
What are the key properties of 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine?
2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine has a molecular weight of 187.23 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-1-(2,2-difluorocyclopropyl)prop-1-en-2-yl]pyrrolidine is sourced from PubChem (CID 164649192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).