About 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole
5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole (PubChem CID 164649717) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole.
Molecular Properties
| Compound Name | 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole |
| PubChem CID | 164649717 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole |
| SMILES | Cc1cn(Cc2ccn[nH]2)cc1C |
| InChI | InChI=1S/C10H13N3/c1-8-5-13(6-9(8)2)7-10-3-4-11-12-10/h3-6H,7H2,1-2H3,(H,11,12) |
| InChIKey | CAPZXEQGUNRFCG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole?
The IUPAC name of 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole (CID 164649717) is 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole.
What is the SMILES notation for 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole?
The canonical SMILES for 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole is Cc1cn(Cc2ccn[nH]2)cc1C.
What is the InChIKey of 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole?
The InChIKey is CAPZXEQGUNRFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-8-5-13(6-9(8)2)7-10-3-4-11-12-10/h3-6H,7H2,1-2H3,(H,11,12).
What are the key properties of 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole?
5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole has a molecular weight of 175.23 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dimethylpyrrol-1-yl)methyl]-1H-pyrazole is sourced from PubChem (CID 164649717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).