C10H8N2O2S — CID 164650911
3-(4-methyl-1,3-thiazol-5-yl)pyridine-4-carboxylic acid (PubChem CID 164650911) has the molecular formula C10H8N2O2S and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-(4-methyl-1,3-thiazol-5-yl)pyridine-4-carboxylic acid.
| Compound Name | 3-(4-methyl-1,3-thiazol-5-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 164650911 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 3-(4-methyl-1,3-thiazol-5-yl)pyridine-4-carboxylic acid |
| SMILES | Cc1ncsc1-c1cnccc1C(=O)O |
| InChI | InChI=1S/C10H8N2O2S/c1-6-9(15-5-12-6)8-4-11-3-2-7(8)10(13)14/h2-5H,1H3,(H,13,14) |
| InChIKey | FOJLVNVRBCVFQQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |