About oxolan-2-yl(1,3-thiazol-5-yl)methanamine
oxolan-2-yl(1,3-thiazol-5-yl)methanamine (PubChem CID 164650938) has the molecular formula C8H12N2OS
and a molecular weight of 184.26 g/mol. Its IUPAC name is oxolan-2-yl(1,3-thiazol-5-yl)methanamine.
Molecular Properties
| Compound Name | oxolan-2-yl(1,3-thiazol-5-yl)methanamine |
| PubChem CID | 164650938 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | oxolan-2-yl(1,3-thiazol-5-yl)methanamine |
| SMILES | NC(c1cncs1)C1CCCO1 |
| InChI | InChI=1S/C8H12N2OS/c9-8(6-2-1-3-11-6)7-4-10-5-12-7/h4-6,8H,1-3,9H2 |
| InChIKey | RNPTYKDCBVRLRZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze oxolan-2-yl(1,3-thiazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-2-yl(1,3-thiazol-5-yl)methanamine?
The IUPAC name of oxolan-2-yl(1,3-thiazol-5-yl)methanamine (CID 164650938) is oxolan-2-yl(1,3-thiazol-5-yl)methanamine.
What is the SMILES notation for oxolan-2-yl(1,3-thiazol-5-yl)methanamine?
The canonical SMILES for oxolan-2-yl(1,3-thiazol-5-yl)methanamine is NC(c1cncs1)C1CCCO1.
What is the InChIKey of oxolan-2-yl(1,3-thiazol-5-yl)methanamine?
The InChIKey is RNPTYKDCBVRLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS/c9-8(6-2-1-3-11-6)7-4-10-5-12-7/h4-6,8H,1-3,9H2.
What are the key properties of oxolan-2-yl(1,3-thiazol-5-yl)methanamine?
oxolan-2-yl(1,3-thiazol-5-yl)methanamine has a molecular weight of 184.26 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-2-yl(1,3-thiazol-5-yl)methanamine is sourced from PubChem (CID 164650938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).