C9H18N2S2 — CID 164651264
(E)-4-(1,2,5-dithiazepan-5-yl)-3-methylbut-2-en-1-amine (PubChem CID 164651264) has the molecular formula C9H18N2S2 and a molecular weight of 218.39 g/mol. Its IUPAC name is (E)-4-(1,2,5-dithiazepan-5-yl)-3-methylbut-2-en-1-amine.
| Compound Name | (E)-4-(1,2,5-dithiazepan-5-yl)-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 164651264 |
| Molecular Formula | C9H18N2S2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (E)-4-(1,2,5-dithiazepan-5-yl)-3-methylbut-2-en-1-amine |
| SMILES | C/C(=C\CN)CN1CCSSCC1 |
| InChI | InChI=1S/C9H18N2S2/c1-9(2-3-10)8-11-4-6-12-13-7-5-11/h2H,3-8,10H2,1H3/b9-2+ |
| InChIKey | XJSFKZBFVBIEDB-XNWCZRBMSA-N |
| XLogP | 1.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|