C9H14N4O — CID 164651415
3-(methylamino)-N-(1H-pyrazol-4-yl)cyclobutane-1-carboxamide (PubChem CID 164651415) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 3-(methylamino)-N-(1H-pyrazol-4-yl)cyclobutane-1-carboxamide.
| Compound Name | 3-(methylamino)-N-(1H-pyrazol-4-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 164651415 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 3-(methylamino)-N-(1H-pyrazol-4-yl)cyclobutane-1-carboxamide |
| SMILES | CNC1CC(C(=O)Nc2cn[nH]c2)C1 |
| InChI | InChI=1S/C9H14N4O/c1-10-7-2-6(3-7)9(14)13-8-4-11-12-5-8/h4-7,10H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | AMULBYIVVQMAMV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |