C11H17BN2O3 — CID 164651800
3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine (PubChem CID 164651800) has the molecular formula C11H17BN2O3 and a molecular weight of 236.08 g/mol. Its IUPAC name is 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine.
| Compound Name | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 164651800 |
| Molecular Formula | C11H17BN2O3 |
| Molecular Weight | 236.08 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine |
| SMILES | CC1(C)COB(c2cnc3n2CCOC3)OC1 |
| InChI | InChI=1S/C11H17BN2O3/c1-11(2)7-16-12(17-8-11)9-5-13-10-6-15-4-3-14(9)10/h5H,3-4,6-8H2,1-2H3 |
| InChIKey | JMRHXDVNKQCPIX-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.08 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|