C9H16N2O2S — CID 164653176
(3-aminocyclobutyl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 164653176) has the molecular formula C9H16N2O2S and a molecular weight of 216.31 g/mol. Its IUPAC name is (3-aminocyclobutyl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (3-aminocyclobutyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 164653176 |
| Molecular Formula | C9H16N2O2S |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | (3-aminocyclobutyl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | NC1CC(C(=O)N2CCS(=O)CC2)C1 |
| InChI | InChI=1S/C9H16N2O2S/c10-8-5-7(6-8)9(12)11-1-3-14(13)4-2-11/h7-8H,1-6,10H2 |
| InChIKey | XDPCXNQGDVBLQJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |