C11H15NO2 — CID 164653417
[2-(2-bicyclo[2.2.1]heptanyl)-1,3-oxazol-5-yl]methanol (PubChem CID 164653417) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanyl)-1,3-oxazol-5-yl]methanol.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanyl)-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 164653417 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanyl)-1,3-oxazol-5-yl]methanol |
| SMILES | OCc1cnc(C2CC3CCC2C3)o1 |
| InChI | InChI=1S/C11H15NO2/c13-6-9-5-12-11(14-9)10-4-7-1-2-8(10)3-7/h5,7-8,10,13H,1-4,6H2 |
| InChIKey | NQPWCIZZYDQRAS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |