About 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol
1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol (PubChem CID 164653636) has the molecular formula C9H14N2OS
and a molecular weight of 198.29 g/mol. Its IUPAC name is 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol |
| PubChem CID | 164653636 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1ccns1)[C@H]1CCNC1 |
| InChI | InChI=1S/C9H14N2OS/c12-9(7-1-3-10-6-7)5-8-2-4-11-13-8/h2,4,7,9-10,12H,1,3,5-6H2/t7-,9?/m0/s1 |
| InChIKey | HWEHMWWVXSMCOW-JAVCKPHESA-N |
| XLogP | 0.66 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol?
The IUPAC name of 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol (CID 164653636) is 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol.
What is the SMILES notation for 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol?
The canonical SMILES for 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol is OC(Cc1ccns1)[C@H]1CCNC1.
What is the InChIKey of 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol?
The InChIKey is HWEHMWWVXSMCOW-JAVCKPHESA-N. The full InChI is InChI=1S/C9H14N2OS/c12-9(7-1-3-10-6-7)5-8-2-4-11-13-8/h2,4,7,9-10,12H,1,3,5-6H2/t7-,9?/m0/s1.
What are the key properties of 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol?
1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol has a molecular weight of 198.29 g/mol, XLogP of 0.66, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-pyrrolidin-3-yl]-2-(1,2-thiazol-5-yl)ethanol is sourced from PubChem (CID 164653636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).