About 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine
1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine (PubChem CID 164653831) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine.
Molecular Properties
| Compound Name | 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine |
| PubChem CID | 164653831 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine |
| SMILES | Cc1nnc(CC2(N)CCC2)s1 |
| InChI | InChI=1S/C8H13N3S/c1-6-10-11-7(12-6)5-8(9)3-2-4-8/h2-5,9H2,1H3 |
| InChIKey | CFJYOMFKVVFGCN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine?
The IUPAC name of 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine (CID 164653831) is 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine.
What is the SMILES notation for 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine?
The canonical SMILES for 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine is Cc1nnc(CC2(N)CCC2)s1.
What is the InChIKey of 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine?
The InChIKey is CFJYOMFKVVFGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c1-6-10-11-7(12-6)5-8(9)3-2-4-8/h2-5,9H2,1H3.
What are the key properties of 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine?
1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine has a molecular weight of 183.28 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]cyclobutan-1-amine is sourced from PubChem (CID 164653831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).