About 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one
1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one (PubChem CID 164654247) has the molecular formula C8H10N4OS
and a molecular weight of 210.26 g/mol. Its IUPAC name is 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one |
| PubChem CID | 164654247 |
| Molecular Formula | C8H10N4OS |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one |
| SMILES | Cc1nnc(Cn2ccn(C)c2=O)s1 |
| InChI | InChI=1S/C8H10N4OS/c1-6-9-10-7(14-6)5-12-4-3-11(2)8(12)13/h3-4H,5H2,1-2H3 |
| InChIKey | BUMHEKSSURQHLU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one?
The IUPAC name of 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one (CID 164654247) is 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one.
What is the SMILES notation for 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one?
The canonical SMILES for 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one is Cc1nnc(Cn2ccn(C)c2=O)s1.
What is the InChIKey of 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one?
The InChIKey is BUMHEKSSURQHLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS/c1-6-9-10-7(14-6)5-12-4-3-11(2)8(12)13/h3-4H,5H2,1-2H3.
What are the key properties of 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one?
1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one has a molecular weight of 210.26 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[(5-methyl-1,3,4-thiadiazol-2-yl)methyl]imidazol-2-one is sourced from PubChem (CID 164654247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).