C9H12BrF2NO — CID 164654784
2-bromo-N-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)propanamide (PubChem CID 164654784) has the molecular formula C9H12BrF2NO and a molecular weight of 268.10 g/mol. Its IUPAC name is 2-bromo-N-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)propanamide.
| Compound Name | 2-bromo-N-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)propanamide |
|---|---|
| PubChem CID | 164654784 |
| Molecular Formula | C9H12BrF2NO |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | 2-bromo-N-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)propanamide |
| SMILES | CC(Br)C(=O)NC1CC2C(C1)C2(F)F |
| InChI | InChI=1S/C9H12BrF2NO/c1-4(10)8(14)13-5-2-6-7(3-5)9(6,11)12/h4-7H,2-3H2,1H3,(H,13,14) |
| InChIKey | FBAPTAXMIQKAOF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|