About [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide
[(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide (PubChem CID 164654879) has the molecular formula C7H14BF3NO2S-
and a molecular weight of 244.07 g/mol. Its IUPAC name is [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide.
Molecular Properties
| Compound Name | [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide |
| PubChem CID | 164654879 |
| Molecular Formula | C7H14BF3NO2S- |
| Molecular Weight | 244.07 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide |
| SMILES | CN(C[B-](F)(F)F)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H14BF3NO2S/c1-12(6-8(9,10)11)7-2-4-15(13,14)5-3-7/h7H,2-6H2,1H3/q-1 |
| InChIKey | SQLPTIRDEJLZNU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.07 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide?
The IUPAC name of [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide (CID 164654879) is [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide.
What is the SMILES notation for [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide?
The canonical SMILES for [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide is CN(C[B-](F)(F)F)C1CCS(=O)(=O)CC1.
What is the InChIKey of [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide?
The InChIKey is SQLPTIRDEJLZNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BF3NO2S/c1-12(6-8(9,10)11)7-2-4-15(13,14)5-3-7/h7H,2-6H2,1H3/q-1.
What are the key properties of [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide?
[(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide has a molecular weight of 244.07 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1,1-dioxothian-4-yl)-methylamino]methyl-trifluoroboranuide is sourced from PubChem (CID 164654879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).