About 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one
1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one (PubChem CID 164655005) has the molecular formula C8H12N4OS
and a molecular weight of 212.28 g/mol. Its IUPAC name is 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one |
| PubChem CID | 164655005 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one |
| SMILES | NN1CCCN(Cc2ccns2)C1=O |
| InChI | InChI=1S/C8H12N4OS/c9-12-5-1-4-11(8(12)13)6-7-2-3-10-14-7/h2-3H,1,4-6,9H2 |
| InChIKey | YFAGMDKSARHCKX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one?
The IUPAC name of 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one (CID 164655005) is 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one?
The canonical SMILES for 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one is NN1CCCN(Cc2ccns2)C1=O.
What is the InChIKey of 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one?
The InChIKey is YFAGMDKSARHCKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4OS/c9-12-5-1-4-11(8(12)13)6-7-2-3-10-14-7/h2-3H,1,4-6,9H2.
What are the key properties of 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one?
1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one has a molecular weight of 212.28 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(1,2-thiazol-5-ylmethyl)-1,3-diazinan-2-one is sourced from PubChem (CID 164655005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).