About 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol
2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol (PubChem CID 164655091) has the molecular formula C6H10N4O2
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol.
Molecular Properties
| Compound Name | 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol |
| PubChem CID | 164655091 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol |
| SMILES | Cc1nc(N)nc(OCCO)n1 |
| InChI | InChI=1S/C6H10N4O2/c1-4-8-5(7)10-6(9-4)12-3-2-11/h11H,2-3H2,1H3,(H2,7,8,9,10) |
| InChIKey | AJQIMOURASGQNB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol?
The IUPAC name of 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol (CID 164655091) is 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol.
What is the SMILES notation for 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol?
The canonical SMILES for 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol is Cc1nc(N)nc(OCCO)n1.
What is the InChIKey of 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol?
The InChIKey is AJQIMOURASGQNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O2/c1-4-8-5(7)10-6(9-4)12-3-2-11/h11H,2-3H2,1H3,(H2,7,8,9,10).
What are the key properties of 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol?
2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol has a molecular weight of 170.17 g/mol, XLogP of -0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-amino-6-methyl-1,3,5-triazin-2-yl)oxy]ethanol is sourced from PubChem (CID 164655091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).