About 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine
2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine (PubChem CID 164655152) has the molecular formula C7H6ClN5S
and a molecular weight of 227.68 g/mol. Its IUPAC name is 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine |
| PubChem CID | 164655152 |
| Molecular Formula | C7H6ClN5S |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(Cl)nc(Sc2ncc[nH]2)n1 |
| InChI | InChI=1S/C7H6ClN5S/c1-4-11-5(8)13-7(12-4)14-6-9-2-3-10-6/h2-3H,1H3,(H,9,10) |
| InChIKey | KRGWNKIFEOJRTN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine?
The IUPAC name of 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine (CID 164655152) is 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine is Cc1nc(Cl)nc(Sc2ncc[nH]2)n1.
What is the InChIKey of 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine?
The InChIKey is KRGWNKIFEOJRTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN5S/c1-4-11-5(8)13-7(12-4)14-6-9-2-3-10-6/h2-3H,1H3,(H,9,10).
What are the key properties of 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine?
2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine has a molecular weight of 227.68 g/mol, XLogP of 1.71, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-(1H-imidazol-2-ylsulfanyl)-6-methyl-1,3,5-triazine is sourced from PubChem (CID 164655152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).