About 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole
1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole (PubChem CID 164655464) has the molecular formula C11H13F2N
and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole.
Molecular Properties
| Compound Name | 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole |
| PubChem CID | 164655464 |
| Molecular Formula | C11H13F2N |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole |
| SMILES | FC1(F)C2CC(Cn3cccc3)CC21 |
| InChI | InChI=1S/C11H13F2N/c12-11(13)9-5-8(6-10(9)11)7-14-3-1-2-4-14/h1-4,8-10H,5-7H2 |
| InChIKey | NMUQHLIVIWDTEB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole?
The IUPAC name of 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole (CID 164655464) is 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole.
What is the SMILES notation for 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole?
The canonical SMILES for 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole is FC1(F)C2CC(Cn3cccc3)CC21.
What is the InChIKey of 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole?
The InChIKey is NMUQHLIVIWDTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N/c12-11(13)9-5-8(6-10(9)11)7-14-3-1-2-4-14/h1-4,8-10H,5-7H2.
What are the key properties of 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole?
1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole has a molecular weight of 197.23 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)methyl]pyrrole is sourced from PubChem (CID 164655464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).