About 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine
1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine (PubChem CID 164655477) has the molecular formula C9H17F2N3
and a molecular weight of 205.25 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine.
Molecular Properties
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine |
| PubChem CID | 164655477 |
| Molecular Formula | C9H17F2N3 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.14 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine |
| SMILES | [H]/N=C(\N)N(C)CC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C9H17F2N3/c1-14(8(12)13)6-7-2-4-9(10,11)5-3-7/h7H,2-6H2,1H3,(H3,12,13) |
| InChIKey | VVNKBYBNAKVSFR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine?
The IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine (CID 164655477) is 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine.
What is the SMILES notation for 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine?
The canonical SMILES for 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine is [H]/N=C(\N)N(C)CC1CCC(F)(F)CC1.
What is the InChIKey of 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine?
The InChIKey is VVNKBYBNAKVSFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2N3/c1-14(8(12)13)6-7-2-4-9(10,11)5-3-7/h7H,2-6H2,1H3,(H3,12,13).
What are the key properties of 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine?
1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine has a molecular weight of 205.25 g/mol, XLogP of 1.64, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,4-difluorocyclohexyl)methyl]-1-methylguanidine is sourced from PubChem (CID 164655477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).