C7H11F2N3 — CID 164655478
2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)guanidine (PubChem CID 164655478) has the molecular formula C7H11F2N3 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)guanidine.
| Compound Name | 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)guanidine |
|---|---|
| PubChem CID | 164655478 |
| Molecular Formula | C7H11F2N3 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-(6,6-difluoro-3-bicyclo[3.1.0]hexanyl)guanidine |
| SMILES | NC(N)=NC1CC2C(C1)C2(F)F |
| InChI | InChI=1S/C7H11F2N3/c8-7(9)4-1-3(2-5(4)7)12-6(10)11/h3-5H,1-2H2,(H4,10,11,12) |
| InChIKey | VLDBQZQNSSTTEZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|