About 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone
2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone (PubChem CID 164655867) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone |
| PubChem CID | 164655867 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone |
| SMILES | O=C(CC1CC=CCC1)C1COCCO1 |
| InChI | InChI=1S/C12H18O3/c13-11(12-9-14-6-7-15-12)8-10-4-2-1-3-5-10/h1-2,10,12H,3-9H2 |
| InChIKey | ADPCSWVSUOVURT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone?
The IUPAC name of 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone (CID 164655867) is 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone.
What is the SMILES notation for 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone?
The canonical SMILES for 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone is O=C(CC1CC=CCC1)C1COCCO1.
What is the InChIKey of 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone?
The InChIKey is ADPCSWVSUOVURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c13-11(12-9-14-6-7-15-12)8-10-4-2-1-3-5-10/h1-2,10,12H,3-9H2.
What are the key properties of 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone?
2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone has a molecular weight of 210.27 g/mol, XLogP of 1.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-3-en-1-yl-1-(1,4-dioxan-2-yl)ethanone is sourced from PubChem (CID 164655867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).