About 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol
2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol (PubChem CID 164656441) has the molecular formula C11H18ClNO
and a molecular weight of 215.72 g/mol. Its IUPAC name is 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol |
| PubChem CID | 164656441 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol |
| SMILES | OC1CCCC1CN1CCC=C(Cl)C1 |
| InChI | InChI=1S/C11H18ClNO/c12-10-4-2-6-13(8-10)7-9-3-1-5-11(9)14/h4,9,11,14H,1-3,5-8H2 |
| InChIKey | PEIISJCWAIZALN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol?
The IUPAC name of 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol (CID 164656441) is 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol.
What is the SMILES notation for 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol?
The canonical SMILES for 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol is OC1CCCC1CN1CCC=C(Cl)C1.
What is the InChIKey of 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol?
The InChIKey is PEIISJCWAIZALN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClNO/c12-10-4-2-6-13(8-10)7-9-3-1-5-11(9)14/h4,9,11,14H,1-3,5-8H2.
What are the key properties of 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol?
2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol has a molecular weight of 215.72 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-3,6-dihydro-2H-pyridin-1-yl)methyl]cyclopentan-1-ol is sourced from PubChem (CID 164656441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).